CAS 1131587-54-6
:Methyl 5-iodo-2-methoxy-4-(phenylmethoxy)benzoate
Description:
Methyl 5-iodo-2-methoxy-4-(phenylmethoxy)benzoate is an organic compound characterized by its complex structure, which includes a benzoate moiety substituted with iodine and methoxy groups. This compound features a methyl ester functional group, contributing to its solubility in organic solvents. The presence of iodine in the structure often imparts unique reactivity, making it a potential candidate for various chemical transformations, including nucleophilic substitution reactions. The methoxy groups enhance the compound's electron-donating properties, which can influence its reactivity and stability. Additionally, the phenylmethoxy substituent may provide steric hindrance and affect the compound's overall polarity. Methyl 5-iodo-2-methoxy-4-(phenylmethoxy)benzoate may find applications in medicinal chemistry, particularly in the synthesis of biologically active molecules, due to its potential as an intermediate in organic synthesis. As with many halogenated compounds, it is essential to handle this substance with care, considering its potential environmental and health impacts.
Formula:C16H15IO4
InChI:InChI=1S/C16H15IO4/c1-19-14-9-15(13(17)8-12(14)16(18)20-2)21-10-11-6-4-3-5-7-11/h3-9H,10H2,1-2H3
InChI key:InChIKey=AVWIOWCGIHNTDK-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(OC)C=C(OCC2=CC=CC=C2)C(I)=C1
Synonyms:- Benzoic acid, 5-iodo-2-methoxy-4-(phenylmethoxy)-, methyl ester
- Methyl 5-iodo-2-methoxy-4-(phenylmethoxy)benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
