
CAS 1131587-55-7
:Methyl 5-iodo-2-methoxy-4-(trifluoromethyl)benzoate
Description:
Methyl 5-iodo-2-methoxy-4-(trifluoromethyl)benzoate is an organic compound characterized by its complex structure, which includes a benzoate moiety substituted with iodine, methoxy, and trifluoromethyl groups. The presence of the iodine atom enhances its reactivity, making it a useful intermediate in various organic synthesis reactions, particularly in the formation of carbon-carbon bonds. The methoxy group contributes to its solubility in organic solvents and can influence its electronic properties, while the trifluoromethyl group is known for imparting unique characteristics such as increased lipophilicity and stability. This compound is typically used in medicinal chemistry and material science due to its potential biological activity and utility in the development of pharmaceuticals. Its molecular structure suggests it may exhibit interesting interactions with biological targets, making it a candidate for further research in drug discovery. Safety and handling precautions should be observed due to the presence of iodine and trifluoromethyl groups, which can pose health and environmental risks.
Formula:C10H8F3IO3
InChI:InChI=1S/C10H8F3IO3/c1-16-8-4-6(10(11,12)13)7(14)3-5(8)9(15)17-2/h3-4H,1-2H3
InChI key:InChIKey=DWQPSNFFVGPRHW-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(OC)C=C(C(F)(F)F)C(I)=C1
Synonyms:- Benzoic acid, 5-iodo-2-methoxy-4-(trifluoromethyl)-, methyl ester
- Methyl 5-iodo-2-methoxy-4-(trifluoromethyl)benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
