CAS 1131587-71-7
:Phenyl 2-amino-5-bromobenzoate
Description:
Phenyl 2-amino-5-bromobenzoate, identified by its CAS number 1131587-71-7, is an organic compound that features a phenyl group attached to a benzoate moiety, which is further substituted with an amino group and a bromine atom. This compound typically exhibits characteristics common to aromatic amines and esters, including a relatively high melting point and moderate solubility in organic solvents. The presence of the amino group can impart basic properties, while the bromine substituent may enhance reactivity in electrophilic aromatic substitution reactions. The compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its structure suggests potential applications in the synthesis of more complex molecules or as an intermediate in organic synthesis. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Overall, Phenyl 2-amino-5-bromobenzoate is a versatile compound with significant implications in both synthetic chemistry and medicinal applications.
Formula:C13H10BrNO2
InChI:InChI=1S/C13H10BrNO2/c14-9-6-7-12(15)11(8-9)13(16)17-10-4-2-1-3-5-10/h1-8H,15H2
InChI key:InChIKey=DZWNIUYTXZGCMQ-UHFFFAOYSA-N
SMILES:C(OC1=CC=CC=C1)(=O)C2=C(N)C=CC(Br)=C2
Synonyms:- Benzoic acid, 2-amino-5-bromo-, phenyl ester
- Phenyl 2-amino-5-bromobenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
