CymitQuimica logo

CAS 1131587-76-2

:

4-Methylphenyl 2-amino-5-bromobenzoate

Description:
4-Methylphenyl 2-amino-5-bromobenzoate, identified by its CAS number 1131587-76-2, is an organic compound that features a benzoate structure with specific substituents. This compound contains a methyl group and an amino group, which influence its chemical reactivity and physical properties. The presence of the bromine atom introduces additional characteristics, such as increased molecular weight and potential for halogen-related reactivity. Typically, compounds like this may exhibit moderate solubility in organic solvents, while their solubility in water can vary based on the functional groups present. The amino group can participate in hydrogen bonding, affecting the compound's interactions with other molecules. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for structural confirmation. Overall, 4-Methylphenyl 2-amino-5-bromobenzoate represents a complex organic molecule with potential applications in various fields, including medicinal chemistry and materials science.
Formula:C14H12BrNO2
InChI:InChI=1S/C14H12BrNO2/c1-9-2-5-11(6-3-9)18-14(17)12-8-10(15)4-7-13(12)16/h2-8H,16H2,1H3
InChI key:InChIKey=SKXWWWPZAHFWMX-UHFFFAOYSA-N
SMILES:C(OC1=CC=C(C)C=C1)(=O)C2=C(N)C=CC(Br)=C2
Synonyms:
  • 4-Methylphenyl 2-amino-5-bromobenzoate
  • Benzoic acid, 2-amino-5-bromo-, 4-methylphenyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.