CymitQuimica logo

CAS 1131587-85-3

:

Methyl 2-(aminomethyl)-5-bromobenzoate

Description:
Methyl 2-(aminomethyl)-5-bromobenzoate is an organic compound characterized by its structure, which includes a bromobenzene ring, an amino group, and an ester functional group. The presence of the bromine atom introduces significant polarity and can influence the compound's reactivity, making it a useful intermediate in various chemical syntheses. The amino group contributes to its potential as a nucleophile, allowing it to participate in reactions such as amination or coupling reactions. As an ester, it exhibits typical properties such as volatility and solubility in organic solvents, while its molecular structure suggests it may have applications in pharmaceuticals or agrochemicals. The compound's specific reactivity and stability can be influenced by factors such as pH and temperature, and it may undergo hydrolysis under certain conditions. Overall, Methyl 2-(aminomethyl)-5-bromobenzoate is a versatile compound with potential utility in synthetic organic chemistry.
Formula:C9H10BrNO2
InChI:InChI=1S/C9H10BrNO2/c1-13-9(12)8-4-7(10)3-2-6(8)5-11/h2-4H,5,11H2,1H3
InChI key:InChIKey=APRBPDMQILLKPH-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(CN)C=CC(Br)=C1
Synonyms:
  • Methyl 2-(aminomethyl)-5-bromobenzoate
  • Benzoic acid, 2-(aminomethyl)-5-bromo-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.