CAS 1131587-88-6
:Methyl 5-bromo-2-(1-pyrrolidinyl)benzoate
Description:
Methyl 5-bromo-2-(1-pyrrolidinyl)benzoate is an organic compound characterized by its structure, which includes a benzoate moiety substituted with a bromine atom and a pyrrolidine ring. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The pyrrolidine group contributes to the compound's basicity and can influence its solubility and interaction with biological systems. This compound is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as an intermediate in the synthesis of more complex molecules. Its molecular structure suggests it may exhibit specific pharmacological properties, although detailed biological activity would require further investigation. Additionally, the compound's stability, solubility in organic solvents, and potential toxicity should be considered in practical applications. Overall, Methyl 5-bromo-2-(1-pyrrolidinyl)benzoate is a versatile compound with significant implications in chemical synthesis and medicinal chemistry.
Formula:C12H14BrNO2
InChI:InChI=1S/C12H14BrNO2/c1-16-12(15)10-8-9(13)4-5-11(10)14-6-2-3-7-14/h4-5,8H,2-3,6-7H2,1H3
InChI key:InChIKey=RJTFAWJIRCCGDL-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(C=CC(Br)=C1)N2CCCC2
Synonyms:- Methyl 5-bromo-2-(1-pyrrolidinyl)benzoate
- Benzoic acid, 5-bromo-2-(1-pyrrolidinyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
