CAS 1131587-89-7
:Methyl 5-bromo-2-(1-piperidinylmethyl)benzoate
Description:
Methyl 5-bromo-2-(1-piperidinylmethyl)benzoate is an organic compound characterized by its complex structure, which includes a benzoate moiety, a bromine substituent, and a piperidine ring. The presence of the bromine atom at the 5-position of the benzene ring enhances its reactivity and can influence its biological activity. The piperidine group, which is a six-membered nitrogen-containing ring, contributes to the compound's potential pharmacological properties, making it of interest in medicinal chemistry. This compound is typically used in research settings, particularly in the synthesis of other chemical entities or as a potential lead compound in drug development. Its solubility and stability can vary depending on the solvent and conditions used, and it may exhibit specific interactions with biological targets due to its functional groups. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns.
Formula:C14H18BrNO2
InChI:InChI=1S/C14H18BrNO2/c1-18-14(17)13-9-12(15)6-5-11(13)10-16-7-3-2-4-8-16/h5-6,9H,2-4,7-8,10H2,1H3
InChI key:InChIKey=YPRYOGZQZYFBJR-UHFFFAOYSA-N
SMILES:C(C1=C(C(OC)=O)C=C(Br)C=C1)N2CCCCC2
Synonyms:- Methyl 5-bromo-2-(1-piperidinylmethyl)benzoate
- Benzoic acid, 5-bromo-2-(1-piperidinylmethyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
