
CAS 1131587-93-3
:Ethyl 5-bromo-2,4-diethoxybenzoate
Description:
Ethyl 5-bromo-2,4-diethoxybenzoate is an organic compound characterized by its ester functional group and the presence of a bromine atom, which contributes to its reactivity and potential applications in organic synthesis. This compound features a benzoate structure, where the ethyl group is attached to the carboxylate moiety, enhancing its solubility in organic solvents. The presence of two ethoxy groups at the 2 and 4 positions on the benzene ring increases the electron density, making the compound more nucleophilic. The bromine substituent at the 5 position can serve as a site for further chemical modifications, such as nucleophilic substitution reactions. Ethyl 5-bromo-2,4-diethoxybenzoate is typically used in synthetic organic chemistry, particularly in the preparation of more complex molecules, including pharmaceuticals and agrochemicals. Its unique structural features allow it to participate in various chemical reactions, making it a valuable intermediate in chemical synthesis. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C13H17BrO4
InChI:InChI=1S/C13H17BrO4/c1-4-16-11-8-12(17-5-2)10(14)7-9(11)13(15)18-6-3/h7-8H,4-6H2,1-3H3
InChI key:InChIKey=VFCGGEMYFJXBHI-UHFFFAOYSA-N
SMILES:O(CC)C1=C(C(OCC)=O)C=C(Br)C(OCC)=C1
Synonyms:- Ethyl 5-bromo-2,4-diethoxybenzoate
- Benzoic acid, 5-bromo-2,4-diethoxy-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
