CAS 1131587-96-6
:Methyl 5-bromo-2-methoxy-4-(phenylmethoxy)benzoate
Description:
Methyl 5-bromo-2-methoxy-4-(phenylmethoxy)benzoate is an organic compound characterized by its complex structure, which includes a bromine atom, methoxy groups, and a phenylmethoxy substituent on a benzoate framework. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for electrophilic substitution reactions due to the presence of the bromine atom. The methoxy groups contribute to its solubility in organic solvents and may influence its reactivity and interaction with other chemical species. The presence of the phenylmethoxy group can enhance its lipophilicity, making it more soluble in non-polar solvents. Additionally, the compound may exhibit interesting biological activities, which can be explored in medicinal chemistry contexts. Its molecular structure suggests potential applications in organic synthesis and as an intermediate in the development of pharmaceuticals or agrochemicals. Overall, Methyl 5-bromo-2-methoxy-4-(phenylmethoxy)benzoate is a versatile compound with significant implications in various fields of chemistry.
Formula:C16H15BrO4
InChI:InChI=1S/C16H15BrO4/c1-19-14-9-15(13(17)8-12(14)16(18)20-2)21-10-11-6-4-3-5-7-11/h3-9H,10H2,1-2H3
InChI key:InChIKey=INNHZNYXHMIODB-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(OC)C=C(OCC2=CC=CC=C2)C(Br)=C1
Synonyms:- Benzoic acid, 5-bromo-2-methoxy-4-(phenylmethoxy)-, methyl ester
- Methyl 5-bromo-2-methoxy-4-(phenylmethoxy)benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
