CAS 1131587-99-9
:Ethyl 2-amino-5-bromo-4-(trifluoromethyl)benzoate
Description:
Ethyl 2-amino-5-bromo-4-(trifluoromethyl)benzoate is an organic compound characterized by its complex structure, which includes an ethyl ester group, an amino group, and a trifluoromethyl substituent on a brominated benzene ring. This compound typically appears as a solid or crystalline substance, and its molecular structure contributes to its unique chemical properties. The presence of the amino group suggests potential for hydrogen bonding, which can influence its solubility and reactivity. The trifluoromethyl group is known for imparting significant lipophilicity and can enhance the compound's biological activity, making it of interest in pharmaceutical applications. The bromine atom adds to the compound's reactivity and can serve as a site for further chemical modifications. Ethyl 2-amino-5-bromo-4-(trifluoromethyl)benzoate may exhibit various properties such as moderate to high melting and boiling points, depending on the intermolecular interactions. Its specific applications and behavior in chemical reactions would depend on the context of its use, particularly in synthetic organic chemistry and medicinal chemistry.
Formula:C10H9BrF3NO2
InChI:InChI=1S/C10H9BrF3NO2/c1-2-17-9(16)5-3-7(11)6(4-8(5)15)10(12,13)14/h3-4H,2,15H2,1H3
InChI key:InChIKey=GSOPSTYLPPBIPU-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(N)C=C(C(F)(F)F)C(Br)=C1
Synonyms:- Ethyl 2-amino-5-bromo-4-(trifluoromethyl)benzoate
- Benzoic acid, 2-amino-5-bromo-4-(trifluoromethyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
