CAS 1131588-05-0
:4-(Difluoromethyl)-3-iodobenzoic acid
Description:
4-(Difluoromethyl)-3-iodobenzoic acid is an organic compound characterized by its unique functional groups and molecular structure. It features a benzoic acid core, which includes a carboxylic acid (-COOH) group, contributing to its acidic properties. The presence of a difluoromethyl group (-CF2H) and an iodine atom at specific positions on the aromatic ring significantly influences its chemical reactivity and physical properties. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the halogen substituents can enhance its lipophilicity. Additionally, the difluoromethyl and iodine groups may impart interesting electronic properties, making it a potential candidate for applications in medicinal chemistry and material science. The compound's reactivity can be further explored in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are common in the synthesis of more complex organic molecules. Overall, 4-(Difluoromethyl)-3-iodobenzoic acid is a versatile compound with potential utility in various chemical applications.
Formula:C8H5F2IO2
InChI:InChI=1S/C8H5F2IO2/c9-7(10)5-2-1-4(8(12)13)3-6(5)11/h1-3,7H,(H,12,13)
InChI key:InChIKey=KTYIFZLLDBZKKG-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(I)=C(C(F)F)C=C1
Synonyms:- 4-(Difluoromethyl)-3-iodobenzoic acid
- Benzoic acid, 4-(difluoromethyl)-3-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

