CAS 1131588-10-7
:3-Iodo-4-(propylamino)benzoic acid
Description:
3-Iodo-4-(propylamino)benzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with an iodine atom and a propylamino group. The presence of the iodine atom at the 3-position of the benzene ring contributes to its unique reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The propylamino group, located at the 4-position, enhances the compound's solubility and may influence its biological activity. This compound is likely to exhibit acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and amidation. Additionally, the presence of both halogen and amine functionalities can lead to interesting interactions in biological systems, making it a candidate for further research in drug design and synthesis. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C10H12INO2
InChI:InChI=1S/C10H12INO2/c1-2-5-12-9-4-3-7(10(13)14)6-8(9)11/h3-4,6,12H,2,5H2,1H3,(H,13,14)
InChI key:InChIKey=QPQLEAYMACVLTH-UHFFFAOYSA-N
SMILES:N(CCC)C1=C(I)C=C(C(O)=O)C=C1
Synonyms:- Benzoic acid, 3-iodo-4-(propylamino)-
- 3-Iodo-4-(propylamino)benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

