CAS 1131588-11-8
:3-Iodo-4-[(1-methylethyl)amino]benzoic acid
Description:
3-Iodo-4-[(1-methylethyl)amino]benzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with an iodine atom and an isopropylamino group. The presence of the iodine atom at the 3-position of the benzene ring contributes to its unique reactivity and potential applications in medicinal chemistry. The isopropylamino group at the 4-position enhances its basicity and may influence its interaction with biological targets. This compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to the hydrophobic nature of the isopropyl group. Its acidic carboxylic group can participate in hydrogen bonding, affecting its overall chemical behavior. The compound may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents, owing to its structural features that could interact with biological systems. As with many halogenated compounds, safety and handling precautions are essential due to potential toxicity and environmental impact.
Formula:C10H12INO2
InChI:InChI=1S/C10H12INO2/c1-6(2)12-9-4-3-7(10(13)14)5-8(9)11/h3-6,12H,1-2H3,(H,13,14)
InChI key:InChIKey=LJUWLIQVMGROKG-UHFFFAOYSA-N
SMILES:N(C(C)C)C1=C(I)C=C(C(O)=O)C=C1
Synonyms:- Benzoic acid, 3-iodo-4-[(1-methylethyl)amino]-
- 3-Iodo-4-[(1-methylethyl)amino]benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

