CAS 1131588-12-9
:3-Iodo-4-propoxybenzoic acid
Description:
3-Iodo-4-propoxybenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with an iodine atom and a propoxy group. The presence of the iodine atom at the 3-position and the propoxy group at the 4-position on the benzene ring influences its chemical reactivity and physical properties. This compound is likely to exhibit moderate solubility in organic solvents due to the hydrophobic nature of the propoxy group, while the carboxylic acid functional group can engage in hydrogen bonding, potentially enhancing solubility in polar solvents. The iodine substituent may impart unique electronic properties, affecting the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, the presence of the carboxylic acid group suggests that it can participate in acid-base reactions, making it a potential candidate for various applications in organic synthesis and medicinal chemistry. Overall, 3-Iodo-4-propoxybenzoic acid is a versatile compound with potential utility in research and industrial applications.
Formula:C10H11IO3
InChI:InChI=1S/C10H11IO3/c1-2-5-14-9-4-3-7(10(12)13)6-8(9)11/h3-4,6H,2,5H2,1H3,(H,12,13)
InChI key:InChIKey=KQOAAPWZYXXRLW-UHFFFAOYSA-N
SMILES:O(CCC)C1=C(I)C=C(C(O)=O)C=C1
Synonyms:- 3-Iodo-4-propoxybenzoic Acid
- Benzoic acid, 3-iodo-4-propoxy-
- 3-Iodo-4-propoxybenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
