CAS 1131588-13-0
:Methyl 4-ethoxy-3-iodobenzoate
Description:
Methyl 4-ethoxy-3-iodobenzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid. It features a methyl ester group, an ethoxy substituent, and an iodine atom attached to the aromatic ring, specifically at the 3-position relative to the ester group and the 4-position relative to the ethoxy group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents such as ethanol and dichloromethane but may have limited solubility in water due to its hydrophobic aromatic structure. Methyl 4-ethoxy-3-iodobenzoate can be utilized in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in synthetic organic chemistry. Its iodine substituent can also serve as a useful handle for further functionalization or as a precursor in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C10H11IO3
InChI:InChI=1S/C10H11IO3/c1-3-14-9-5-4-7(6-8(9)11)10(12)13-2/h4-6H,3H2,1-2H3
InChI key:InChIKey=WOQIEYLCMSOXPO-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(I)=C(OCC)C=C1
Synonyms:- Benzoic acid, 4-ethoxy-3-iodo-, methyl ester
- Methyl 4-ethoxy-3-iodobenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
