CAS 1131588-15-2
:3-Iodo-4-(2H-tetrazol-5-yl)benzoic acid
Description:
3-Iodo-4-(2H-tetrazol-5-yl)benzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety substituted with an iodine atom and a tetrazole group. The presence of the iodine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The tetrazole ring contributes to the compound's potential as a bioisostere for carboxylic acids, often improving pharmacokinetic properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid functional group. Its synthesis often involves multi-step organic reactions, and it may be utilized in various applications, including drug development and as a building block in organic synthesis. The compound's properties, such as melting point, boiling point, and spectral characteristics, would be determined through experimental methods and can vary based on purity and environmental conditions. Overall, 3-Iodo-4-(2H-tetrazol-5-yl)benzoic acid represents a versatile structure in the field of organic and medicinal chemistry.
Formula:C8H5IN4O2
InChI:InChI=1S/C8H5IN4O2/c9-6-3-4(8(14)15)1-2-5(6)7-10-12-13-11-7/h1-3H,(H,14,15)(H,10,11,12,13)
InChI key:InChIKey=ZTJYFGKYTVPQQK-UHFFFAOYSA-N
SMILES:IC1=C(C=CC(C(O)=O)=C1)C=2NN=NN2
Synonyms:- 3-Iodo-4-(2H-tetrazol-5-yl)benzoic acid
- Benzoic acid, 3-iodo-4-(2H-tetrazol-5-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
