CAS 1131588-16-3
:3-Iodo-4-(1-pyrrolidinyl)benzoic acid
Description:
3-Iodo-4-(1-pyrrolidinyl)benzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety substituted with an iodine atom and a pyrrolidine ring. The presence of the iodine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The pyrrolidine group contributes to the compound's potential as a ligand in various biological systems, possibly affecting its interaction with receptors or enzymes. This compound is likely to exhibit moderate solubility in organic solvents and may have limited solubility in water due to the hydrophobic nature of the aromatic ring and the pyrrolidine moiety. Its acidic functional group (carboxylic acid) can participate in hydrogen bonding, influencing its overall reactivity and interaction with other molecules. As with many halogenated compounds, safety precautions should be taken when handling due to potential toxicity. Overall, 3-Iodo-4-(1-pyrrolidinyl)benzoic acid represents a versatile structure with potential applications in pharmaceuticals and chemical research.
Formula:C11H12INO2
InChI:InChI=1S/C11H12INO2/c12-9-7-8(11(14)15)3-4-10(9)13-5-1-2-6-13/h3-4,7H,1-2,5-6H2,(H,14,15)
InChI key:InChIKey=HEJDNUMEEPEOLR-UHFFFAOYSA-N
SMILES:IC1=C(C=CC(C(O)=O)=C1)N2CCCC2
Synonyms:- Benzoic acid, 3-iodo-4-(1-pyrrolidinyl)-
- 3-Iodo-4-(1-pyrrolidinyl)benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
