
CAS 1131588-20-9
:4-(2,2-Dimethylpropyl)-3-iodobenzoic acid
Description:
4-(2,2-Dimethylpropyl)-3-iodobenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with an iodine atom and a branched alkyl group. The presence of the iodine atom introduces notable properties, such as increased molecular weight and potential for reactivity in nucleophilic substitution reactions. The 2,2-dimethylpropyl group contributes to the compound's hydrophobic characteristics, influencing its solubility in organic solvents rather than in water. This compound may exhibit interesting biological activity due to its structural features, making it a candidate for various applications in medicinal chemistry or material science. Additionally, the presence of the carboxylic acid functional group allows for potential interactions with biological systems, including hydrogen bonding and acid-base reactions. Overall, 4-(2,2-Dimethylpropyl)-3-iodobenzoic acid is a complex molecule with unique properties that can be explored in various chemical and pharmaceutical contexts.
Formula:C12H15IO2
InChI:InChI=1S/C12H15IO2/c1-12(2,3)7-9-5-4-8(11(14)15)6-10(9)13/h4-6H,7H2,1-3H3,(H,14,15)
InChI key:InChIKey=DZSQYSGNPHEEBZ-UHFFFAOYSA-N
SMILES:C(C(C)(C)C)C1=C(I)C=C(C(O)=O)C=C1
Synonyms:- Benzoic acid, 4-(2,2-dimethylpropyl)-3-iodo-
- 4-(2,2-Dimethylpropyl)-3-iodobenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
