CAS 1131588-21-0
:4-(1,1-Dimethylpropyl)-3-iodobenzoic acid
Description:
4-(1,1-Dimethylpropyl)-3-iodobenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with both a 1,1-dimethylpropyl group and an iodine atom. The presence of the iodine atom introduces significant polarity and can influence the compound's reactivity, particularly in nucleophilic substitution reactions. The bulky 1,1-dimethylpropyl group contributes to steric hindrance, which may affect the compound's solubility and interaction with other molecules. This compound is likely to exhibit moderate to low solubility in water due to the hydrophobic nature of the alkyl substituent, while its carboxylic acid functional group can engage in hydrogen bonding, enhancing solubility in polar solvents. Additionally, the compound may display interesting biological activities, making it a candidate for various applications in medicinal chemistry or material science. Its specific properties, such as melting point, boiling point, and spectral characteristics, would need to be determined through experimental methods for precise applications.
Formula:C12H15IO2
InChI:InChI=1S/C12H15IO2/c1-4-12(2,3)9-6-5-8(11(14)15)7-10(9)13/h5-7H,4H2,1-3H3,(H,14,15)
InChI key:InChIKey=DSXDMGOYNKPGFL-UHFFFAOYSA-N
SMILES:C(CC)(C)(C)C1=C(I)C=C(C(O)=O)C=C1
Synonyms:- 4-(1,1-Dimethylpropyl)-3-iodobenzoic acid
- Benzoic acid, 4-(1,1-dimethylpropyl)-3-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
