CAS 1131594-10-9
:3-Bromo-4-[(2-methylpropyl)amino]benzoic acid
Description:
3-Bromo-4-[(2-methylpropyl)amino]benzoic acid is an organic compound characterized by its aromatic structure, which includes a bromine substituent and an amino group attached to a benzoic acid framework. The presence of the bromine atom introduces a halogen functionality, which can influence the compound's reactivity and solubility. The amino group, specifically a branched alkyl amine (2-methylpropyl), contributes to the compound's basicity and potential for forming hydrogen bonds, enhancing its solubility in polar solvents. As a benzoic acid derivative, it possesses acidic properties, allowing it to participate in acid-base reactions. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Overall, the combination of the bromine atom, amino group, and carboxylic acid functionality provides a unique profile that can be exploited in various chemical and biological applications.
Formula:C11H14BrNO2
InChI:InChI=1S/C11H14BrNO2/c1-7(2)6-13-10-4-3-8(11(14)15)5-9(10)12/h3-5,7,13H,6H2,1-2H3,(H,14,15)
InChI key:InChIKey=GMFZGXDWHXZXOO-UHFFFAOYSA-N
SMILES:N(CC(C)C)C1=C(Br)C=C(C(O)=O)C=C1
Synonyms:- Benzoic acid, 3-bromo-4-[(2-methylpropyl)amino]-
- 3-Bromo-4-[(2-methylpropyl)amino]benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
