CymitQuimica logo

CAS 1131594-13-2

:

3-Bromo-4-[(1-methylethoxy)methyl]benzoic acid

Description:
3-Bromo-4-[(1-methylethoxy)methyl]benzoic acid is an organic compound characterized by its aromatic structure, which includes a bromine substituent and a carboxylic acid functional group. The presence of the bromine atom enhances its reactivity and can influence its physical properties, such as solubility and boiling point. The compound features an ethoxy group, which contributes to its overall hydrophobic character while also providing potential sites for further chemical reactions. As a benzoic acid derivative, it exhibits acidic properties, allowing it to participate in various chemical reactions, including esterification and nucleophilic substitution. The compound's molecular structure suggests it may have applications in pharmaceuticals or as an intermediate in organic synthesis. Its specific reactivity and interactions would depend on the surrounding conditions, such as pH and temperature. Safety data and handling precautions should be considered, as with any chemical substance, particularly those containing halogens and functional groups that may pose hazards.
Formula:C11H13BrO3
InChI:InChI=1S/C11H13BrO3/c1-7(2)15-6-9-4-3-8(11(13)14)5-10(9)12/h3-5,7H,6H2,1-2H3,(H,13,14)
InChI key:InChIKey=SYDPTTFGANLEIM-UHFFFAOYSA-N
SMILES:C(OC(C)C)C1=C(Br)C=C(C(O)=O)C=C1
Synonyms:
  • 3-Bromo-4-[(1-methylethoxy)methyl]benzoic acid
  • Benzoic acid, 3-bromo-4-[(1-methylethoxy)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.