CAS 1131594-16-5
:Methyl 3-bromo-4-(1-pyrrolidinyl)benzoate
Description:
Methyl 3-bromo-4-(1-pyrrolidinyl)benzoate is an organic compound characterized by its structure, which includes a benzoate moiety substituted with a bromine atom and a pyrrolidine ring. This compound features a methyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of the bromine atom introduces electrophilic characteristics, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The pyrrolidine group enhances its biological activity, as it can interact with various biological targets, potentially influencing pharmacological properties. This compound may be utilized in medicinal chemistry for the development of new therapeutic agents or as an intermediate in organic synthesis. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns.
Formula:C12H14BrNO2
InChI:InChI=1S/C12H14BrNO2/c1-16-12(15)9-4-5-11(10(13)8-9)14-6-2-3-7-14/h4-5,8H,2-3,6-7H2,1H3
InChI key:InChIKey=ULPJSJRZHVIRJL-UHFFFAOYSA-N
SMILES:BrC1=C(C=CC(C(OC)=O)=C1)N2CCCC2
Synonyms:- Benzoic acid, 3-bromo-4-(1-pyrrolidinyl)-, methyl ester
- Methyl 3-bromo-4-(1-pyrrolidinyl)benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
