CAS 1131594-17-6
:3-Bromo-4-(cyclopentyloxy)benzoic acid
Description:
3-Bromo-4-(cyclopentyloxy)benzoic acid is an organic compound characterized by its aromatic structure, which includes a bromine substituent and a cyclopentyloxy group attached to a benzoic acid moiety. The presence of the bromine atom introduces both electronegative character and potential for further chemical reactivity, while the cyclopentyloxy group contributes to the compound's hydrophobic properties and steric bulk. This compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to its hydrophobic characteristics. The carboxylic acid functional group provides acidic properties, allowing for potential interactions in various chemical environments, including hydrogen bonding and salt formation. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in organic synthesis, medicinal chemistry, and materials science. As with many brominated compounds, it is essential to handle it with care due to potential environmental and health impacts associated with brominated organic substances.
Formula:C12H13BrO3
InChI:InChI=1S/C12H13BrO3/c13-10-7-8(12(14)15)5-6-11(10)16-9-3-1-2-4-9/h5-7,9H,1-4H2,(H,14,15)
InChI key:InChIKey=ATRXLIXURCTCRD-UHFFFAOYSA-N
SMILES:O(C1=C(Br)C=C(C(O)=O)C=C1)C2CCCC2
Synonyms:- 3-Bromo-4-(cyclopentyloxy)benzoic Acid
- 3-Bromo-4-(cyclopentyloxy)benzoic acid
- Benzoic acid, 3-bromo-4-(cyclopentyloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
