CAS 1131594-22-3
:3-Bromo-4-[(2-methyl-1-oxopropyl)amino]benzoic acid
Description:
3-Bromo-4-[(2-methyl-1-oxopropyl)amino]benzoic acid is an organic compound characterized by its aromatic structure, which includes a bromine substituent and an amino group linked to a carboxylic acid. The presence of the bromine atom introduces notable reactivity and influences the compound's physical properties, such as solubility and melting point. The amino group contributes to the compound's basicity and potential for forming hydrogen bonds, while the carboxylic acid group imparts acidic characteristics. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of drug candidates. Additionally, the presence of the 2-methyl-1-oxopropyl moiety may enhance lipophilicity, affecting the compound's pharmacokinetics. Overall, 3-Bromo-4-[(2-methyl-1-oxopropyl)amino]benzoic acid is a complex molecule with diverse chemical properties that can be explored for various applications in organic synthesis and drug development.
Formula:C11H12BrNO3
InChI:InChI=1S/C11H12BrNO3/c1-6(2)10(14)13-9-4-3-7(11(15)16)5-8(9)12/h3-6H,1-2H3,(H,13,14)(H,15,16)
InChI key:InChIKey=RWAOOQHWTROBQN-UHFFFAOYSA-N
SMILES:N(C(C(C)C)=O)C1=C(Br)C=C(C(O)=O)C=C1
Synonyms:- Benzoic acid, 3-bromo-4-[(2-methyl-1-oxopropyl)amino]-
- 3-Bromo-4-[(2-methyl-1-oxopropyl)amino]benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
