
CAS 1131594-35-8
:3-Bromo-4-(2-ethoxyethoxy)benzoic acid
Description:
3-Bromo-4-(2-ethoxyethoxy)benzoic acid is an organic compound characterized by its aromatic structure, which includes a bromine substituent and a carboxylic acid functional group. The presence of the bromine atom introduces both electronegative character and potential for further chemical reactivity, while the carboxylic acid group contributes to its acidity and solubility in polar solvents. The ethoxyethoxy substituent enhances the compound's hydrophilicity, making it more soluble in aqueous environments compared to similar compounds without such groups. This compound may exhibit interesting properties such as potential biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in different chemical environments. Additionally, the compound's stability and reactivity can be affected by the presence of the bromine atom and the carboxylic acid group, which may participate in various chemical reactions, including esterification and nucleophilic substitution. Overall, 3-Bromo-4-(2-ethoxyethoxy)benzoic acid is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C11H13BrO4
InChI:InChI=1S/C11H13BrO4/c1-2-15-5-6-16-10-4-3-8(11(13)14)7-9(10)12/h3-4,7H,2,5-6H2,1H3,(H,13,14)
InChI key:InChIKey=XMYFGSYTGKTLTJ-UHFFFAOYSA-N
SMILES:O(CCOCC)C1=C(Br)C=C(C(O)=O)C=C1
Synonyms:- 3-Bromo-4-(2-ethoxyethoxy)benzoic acid
- Benzoic acid, 3-bromo-4-(2-ethoxyethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
