
CAS 1131594-40-5
:3-Bromo-4-(4-methyl-1-piperidinyl)benzoic acid
Description:
3-Bromo-4-(4-methyl-1-piperidinyl)benzoic acid is an organic compound characterized by its aromatic structure, which includes a bromine substituent and a piperidine ring. The presence of the bromine atom introduces a halogen functionality, which can influence the compound's reactivity and solubility. The piperidine moiety, a six-membered nitrogen-containing ring, contributes to the compound's basicity and potential interactions with biological systems. As a benzoic acid derivative, it features a carboxylic acid functional group, which imparts acidic properties and allows for hydrogen bonding. This compound may exhibit interesting pharmacological activities due to its structural features, making it a subject of interest in medicinal chemistry. Its molecular interactions can be influenced by the steric and electronic effects of the bromine and piperidine groups, potentially affecting its biological activity and solubility in various solvents. Overall, 3-Bromo-4-(4-methyl-1-piperidinyl)benzoic acid is a complex molecule with diverse chemical properties that can be explored for various applications in research and development.
Formula:C13H16BrNO2
InChI:InChI=1S/C13H16BrNO2/c1-9-4-6-15(7-5-9)12-3-2-10(13(16)17)8-11(12)14/h2-3,8-9H,4-7H2,1H3,(H,16,17)
InChI key:InChIKey=OZGVMRNJOFLCSG-UHFFFAOYSA-N
SMILES:BrC1=C(C=CC(C(O)=O)=C1)N2CCC(C)CC2
Synonyms:- Benzoic acid, 3-bromo-4-(4-methyl-1-piperidinyl)-
- 3-Bromo-4-(4-methyl-1-piperidinyl)benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
