CAS 1131594-41-6
:3-Bromo-4-(2-methyl-1-piperidinyl)benzoic acid
Description:
3-Bromo-4-(2-methyl-1-piperidinyl)benzoic acid is an organic compound characterized by its aromatic structure, which includes a bromine substituent and a piperidine ring. The presence of the bromine atom introduces a halogen functionality, which can influence the compound's reactivity and solubility. The piperidine moiety, a six-membered nitrogen-containing ring, contributes to the compound's basicity and potential for forming hydrogen bonds, enhancing its interaction with biological targets. As a benzoic acid derivative, it features a carboxylic acid functional group, which imparts acidic properties and can participate in various chemical reactions, such as esterification or amidation. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific properties, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is studied. Overall, 3-Bromo-4-(2-methyl-1-piperidinyl)benzoic acid is a versatile compound with potential applications in pharmaceuticals and organic synthesis.
Formula:C13H16BrNO2
InChI:InChI=1S/C13H16BrNO2/c1-9-4-2-3-7-15(9)12-6-5-10(13(16)17)8-11(12)14/h5-6,8-9H,2-4,7H2,1H3,(H,16,17)
InChI key:InChIKey=NOEMUWNIMVNEMT-UHFFFAOYSA-N
SMILES:BrC1=C(C=CC(C(O)=O)=C1)N2C(C)CCCC2
Synonyms:- 3-Bromo-4-(2-methyl-1-piperidinyl)benzoic acid
- Benzoic acid, 3-bromo-4-(2-methyl-1-piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
