CAS 1131594-44-9
:Methyl 3-bromo-4-(1-piperidinyl)benzoate
Description:
Methyl 3-bromo-4-(1-piperidinyl)benzoate is an organic compound characterized by its structure, which includes a benzoate moiety substituted with a bromine atom and a piperidine ring. This compound features a methyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of the bromine atom introduces electrophilic characteristics, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The piperidine ring enhances the compound's basicity and can participate in further chemical transformations. Methyl 3-bromo-4-(1-piperidinyl)benzoate is of interest in medicinal chemistry and drug development due to its potential biological activity, particularly in the context of developing compounds that interact with biological targets. Its properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other functional groups. As with many organic compounds, safety and handling precautions are essential due to potential toxicity and reactivity.
Formula:C13H16BrNO2
InChI:InChI=1S/C13H16BrNO2/c1-17-13(16)10-5-6-12(11(14)9-10)15-7-3-2-4-8-15/h5-6,9H,2-4,7-8H2,1H3
InChI key:InChIKey=DLWDJRTZLPMNJY-UHFFFAOYSA-N
SMILES:BrC1=C(C=CC(C(OC)=O)=C1)N2CCCCC2
Synonyms:- Methyl 3-bromo-4-(1-piperidinyl)benzoate
- Benzoic acid, 3-bromo-4-(1-piperidinyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
