CAS 1131594-52-9
:Ethyl 3-bromo-4-(butylamino)benzoate
Description:
Ethyl 3-bromo-4-(butylamino)benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid. The presence of a bromine atom at the 3-position and a butylamino group at the 4-position of the aromatic ring contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents such as ethanol and dichloromethane but may have limited solubility in water due to its hydrophobic butylamino group. Ethyl 3-bromo-4-(butylamino)benzoate can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in organic synthesis. Its potential applications may extend to pharmaceuticals, agrochemicals, or materials science, depending on the specific reactivity and functionalization of the compound. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C13H18BrNO2
InChI:InChI=1S/C13H18BrNO2/c1-3-5-8-15-12-7-6-10(9-11(12)14)13(16)17-4-2/h6-7,9,15H,3-5,8H2,1-2H3
InChI key:InChIKey=PQKYOQWSDZEAQC-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC(Br)=C(NCCCC)C=C1
Synonyms:- Ethyl 3-bromo-4-(butylamino)benzoate
- Benzoic acid, 3-bromo-4-(butylamino)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
