CAS 1131594-58-5
:Ethyl 3-bromo-4-(2-methyl-1-pyrrolidinyl)benzoate
Description:
Ethyl 3-bromo-4-(2-methyl-1-pyrrolidinyl)benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethanol. The presence of a bromine atom at the 3-position of the aromatic ring contributes to its reactivity and potential applications in organic synthesis. The 4-position features a substituent containing a 2-methyl-1-pyrrolidinyl group, which introduces a cyclic amine structure, enhancing the compound's potential for biological activity and interaction with various receptors. This compound is likely to be a white to off-white solid or a viscous liquid, depending on its purity and specific conditions. Its molecular structure suggests it may exhibit moderate solubility in organic solvents while being less soluble in water due to the hydrophobic nature of the aromatic and aliphatic components. Ethyl 3-bromo-4-(2-methyl-1-pyrrolidinyl)benzoate may be of interest in medicinal chemistry and drug development, particularly in the design of compounds with potential pharmacological properties.
Formula:C14H18BrNO2
InChI:InChI=1S/C14H18BrNO2/c1-3-18-14(17)11-6-7-13(12(15)9-11)16-8-4-5-10(16)2/h6-7,9-10H,3-5,8H2,1-2H3
InChI key:InChIKey=MDDZJPQWMCQCAT-UHFFFAOYSA-N
SMILES:BrC1=C(C=CC(C(OCC)=O)=C1)N2C(C)CCC2
Synonyms:- Benzoic acid, 3-bromo-4-(2-methyl-1-pyrrolidinyl)-, ethyl ester
- Ethyl 3-bromo-4-(2-methyl-1-pyrrolidinyl)benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
