CymitQuimica logo

CAS 1131594-59-6

:

3-Bromo-4-[(2-methyl-1-piperidinyl)methyl]benzoic acid

Description:
3-Bromo-4-[(2-methyl-1-piperidinyl)methyl]benzoic acid is a chemical compound characterized by its complex structure, which includes a bromine atom, a benzoic acid moiety, and a piperidine ring. The presence of the bromine substituent on the benzene ring enhances its reactivity and can influence its biological activity. The piperidine group, specifically the 2-methyl-1-piperidinyl, contributes to the compound's potential pharmacological properties, as piperidine derivatives are often associated with various biological activities, including analgesic and anti-inflammatory effects. The carboxylic acid functional group in the benzoic acid portion allows for hydrogen bonding and increases solubility in polar solvents. This compound may be of interest in medicinal chemistry and drug development due to its structural features that could interact with biological targets. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including nucleophilic substitution and functional group transformations. Overall, 3-Bromo-4-[(2-methyl-1-piperidinyl)methyl]benzoic acid represents a versatile scaffold for further chemical exploration and potential therapeutic applications.
Formula:C14H18BrNO2
InChI:InChI=1S/C14H18BrNO2/c1-10-4-2-3-7-16(10)9-12-6-5-11(14(17)18)8-13(12)15/h5-6,8,10H,2-4,7,9H2,1H3,(H,17,18)
InChI key:InChIKey=FLXTZNAJXZWZTA-UHFFFAOYSA-N
SMILES:C(C1=C(Br)C=C(C(O)=O)C=C1)N2C(C)CCCC2
Synonyms:
  • 3-Bromo-4-[(2-methyl-1-piperidinyl)methyl]benzoic acid
  • Benzoic acid, 3-bromo-4-[(2-methyl-1-piperidinyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.