CymitQuimica logo

CAS 1131594-60-9

:

3-Bromo-4-[(3-methyl-1-piperidinyl)methyl]benzoic acid

Description:
3-Bromo-4-[(3-methyl-1-piperidinyl)methyl]benzoic acid is a chemical compound characterized by its complex structure, which includes a bromine atom, a benzoic acid moiety, and a piperidine ring. The presence of the bromine substituent on the benzene ring enhances its reactivity and can influence its biological activity. The piperidine group, specifically the 3-methyl substitution, contributes to the compound's potential pharmacological properties, making it of interest in medicinal chemistry. This compound is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water. Its molecular structure suggests potential interactions with biological targets, which may be explored in drug development. The compound's properties, such as melting point, boiling point, and specific reactivity, would be determined through experimental methods, and its safety profile would need to be assessed for any toxicological effects. Overall, 3-Bromo-4-[(3-methyl-1-piperidinyl)methyl]benzoic acid represents a significant compound for research in various chemical and pharmaceutical applications.
Formula:C14H18BrNO2
InChI:InChI=1S/C14H18BrNO2/c1-10-3-2-6-16(8-10)9-12-5-4-11(14(17)18)7-13(12)15/h4-5,7,10H,2-3,6,8-9H2,1H3,(H,17,18)
InChI key:InChIKey=LGCJZTZVMALETP-UHFFFAOYSA-N
SMILES:C(C1=C(Br)C=C(C(O)=O)C=C1)N2CC(C)CCC2
Synonyms:
  • 3-Bromo-4-[(3-methyl-1-piperidinyl)methyl]benzoic acid
  • Benzoic acid, 3-bromo-4-[(3-methyl-1-piperidinyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.