CymitQuimica logo

CAS 1131594-79-0

:

Phenylmethyl 3-[3-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-1-azetidinyl]-1-piperidinecarboxylate

Description:
Phenylmethyl 3-[3-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-1-azetidinyl]-1-piperidinecarboxylate, identified by its CAS number 1131594-79-0, is a synthetic organic compound characterized by its complex structure, which includes multiple functional groups such as an ester, amine, and azetidine ring. This compound typically exhibits properties associated with both lipophilicity and hydrophilicity due to the presence of various substituents, which can influence its solubility in different solvents. The azetidine and piperidine rings contribute to its potential biological activity, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which may be relevant for pharmacological applications. Additionally, the presence of the dimethylethoxycarbonyl group indicates that it may undergo hydrolysis or other chemical transformations under specific conditions. Overall, this compound's unique characteristics make it a subject of interest for further research in drug development and related fields.
Formula:C22H33N3O4
InChI:InChI=1S/C22H33N3O4/c1-22(2,3)29-20(26)23-12-18-13-25(14-18)19-10-7-11-24(15-19)21(27)28-16-17-8-5-4-6-9-17/h4-6,8-9,18-19H,7,10-16H2,1-3H3,(H,23,26)
InChI key:InChIKey=NCUKIHWBFRKPMO-UHFFFAOYSA-N
SMILES:C(NC(OC(C)(C)C)=O)C1CN(C1)C2CN(C(OCC3=CC=CC=C3)=O)CCC2
Synonyms:
  • 1-Piperidinecarboxylic acid, 3-[3-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-1-azetidinyl]-, phenylmethyl ester
  • Phenylmethyl 3-[3-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-1-azetidinyl]-1-piperidinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.