CAS 1131594-83-6
:Methyl [1,3′-biazetidine]-3-carboxylate
Description:
Methyl [1,3′-biazetidine]-3-carboxylate is a chemical compound characterized by its unique bicyclic structure, which includes a carboxylate functional group and a methyl ester. This compound is part of the azetidine family, featuring a nitrogen-containing heterocycle that contributes to its reactivity and potential biological activity. The presence of the carboxylate group suggests that it can participate in various chemical reactions, such as esterification and amidation. Methyl [1,3′-biazetidine]-3-carboxylate may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which could lead to applications in drug development. Additionally, the compound's solubility and stability in various solvents can influence its behavior in chemical reactions and biological systems. Overall, Methyl [1,3′-biazetidine]-3-carboxylate represents a versatile compound with potential applications in both synthetic chemistry and pharmacology.
Formula:C8H14N2O2
InChI:InChI=1S/C8H14N2O2/c1-12-8(11)6-4-10(5-6)7-2-9-3-7/h6-7,9H,2-5H2,1H3
InChI key:InChIKey=IREUKINWQIFJHT-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1CN(C1)C2CNC2
Synonyms:- [1,3′-Biazetidine]-3-carboxylic acid, methyl ester
- Methyl [1,3′-biazetidine]-3-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
