CAS 1131594-85-8

Phenylmethyl N-[[3-(aminomethyl)phenyl]methyl]-N-methylcarbamate

Description:

Phenylmethyl N-[[3-(aminomethyl)phenyl]methyl]-N-methylcarbamate, identified by its CAS number 1131594-85-8, is a chemical compound that belongs to the class of carbamates. This substance typically exhibits characteristics such as being a white to off-white solid, with potential solubility in organic solvents. Its molecular structure features a carbamate functional group, which is known for its reactivity and ability to form hydrogen bonds, influencing its biological activity and interactions. The presence of the aminomethyl and phenyl groups suggests that it may have applications in medicinal chemistry, possibly as a pharmaceutical agent or a research chemical. The compound's specific properties, such as melting point, boiling point, and spectral data, would be essential for understanding its behavior in various environments. Additionally, safety data sheets would provide crucial information regarding its handling, toxicity, and environmental impact, which are important for any practical applications or research involving this compound.

Formula: C₁₇H₂₀N₂O₂

InChI: InChI=1S/C17H20N2O2/c1-19(12-16-9-5-8-15(10-16)11-18)17(20)21-13-14-6-3-2-4-7-14/h2-10H,11-13,18H2,1H3

InChI key: InChIKey=XNAKKNOGFJVCCY-UHFFFAOYSA-N

SMILES: C(N(C(OCC1=CC=CC=C1)=O)C)C2=CC(CN)=CC=C2

Synonyms:

• Phenylmethyl N-[[3-(aminomethyl)phenyl]methyl]-N-methylcarbamate
• Carbamic acid, N-[[3-(aminomethyl)phenyl]methyl]-N-methyl-, phenylmethyl ester