CymitQuimica logo

CAS 1131594-87-0

:

1′-(Phenylmethyl) [1,3′-biazetidine]-1′,3-dicarboxylate

Description:
1′-(Phenylmethyl) [1,3′-biazetidine]-1′,3-dicarboxylate is a chemical compound characterized by its unique structural features, which include a bicyclic framework and multiple functional groups. The presence of the phenylmethyl group contributes to its aromatic properties, while the dicarboxylate moiety indicates the presence of two carboxylic acid derivatives, which can influence its reactivity and solubility. This compound may exhibit interesting biological activities due to its structural complexity, potentially making it a candidate for pharmaceutical applications. The bicyclic structure suggests that it may have conformational rigidity, which can affect its interaction with biological targets. Additionally, the presence of ester linkages in the dicarboxylate may enhance its lipophilicity, impacting its absorption and distribution in biological systems. Overall, the characteristics of this compound make it a subject of interest in medicinal chemistry and related fields, although specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C15H18N2O4
InChI:InChI=1S/C15H18N2O4/c18-14(19)12-6-16(7-12)13-8-17(9-13)15(20)21-10-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2,(H,18,19)
InChI key:InChIKey=HAXZEKLANUVRIN-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2CC(C2)N3CC(C(O)=O)C3
Synonyms:
  • [1,3′-Biazetidine]-1′,3-dicarboxylic acid, 1′-(phenylmethyl) ester
  • 1′-(Phenylmethyl) [1,3′-biazetidine]-1′,3-dicarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.