CAS 1131594-94-9
:3-Ethylamino-piperidine-1-carboxylic acid benzyl ester
Description:
3-Ethylamino-piperidine-1-carboxylic acid benzyl ester is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The presence of an ethylamino group indicates that there is an ethyl substituent attached to the amino group, contributing to its basicity and potential for forming hydrogen bonds. The carboxylic acid moiety suggests that the compound can participate in acid-base reactions and may exhibit acidic properties. The benzyl ester functionality indicates that the carboxylic acid is esterified with a benzyl group, which can influence the compound's solubility and reactivity. This compound may be of interest in medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals targeting various receptors or enzymes. Its structural features suggest it could interact with biological systems, making it a candidate for further investigation in drug development. As with many organic compounds, its physical properties, such as solubility and melting point, would depend on the specific conditions and purity of the sample.
Formula:C15H22N2O2
InChI:InChI=1S/C15H22N2O2/c1-2-16-14-9-6-10-17(11-14)15(18)19-12-13-7-4-3-5-8-13/h3-5,7-8,14,16H,2,6,9-12H2,1H3
SMILES:CCNC1CCCN(C1)C(=O)OCc1ccccc1
Synonyms:- Benzyl 3-(ethylamino)-1-piperidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
