
CAS 1131595-04-4
:4-[[[(Phenylmethoxy)carbonyl]amino]methyl]benzenepropanoic acid
Description:
4-[[[(Phenylmethoxy)carbonyl]amino]methyl]benzenepropanoic acid, identified by its CAS number 1131595-04-4, is a chemical compound characterized by its complex structure, which includes a benzene ring, a propanoic acid moiety, and an amide functional group. This compound features a phenylmethoxycarbonyl group that contributes to its reactivity and solubility properties. It is likely to exhibit both hydrophilic and hydrophobic characteristics due to the presence of polar functional groups and aromatic rings. The compound may be of interest in pharmaceutical applications, particularly in drug design and synthesis, due to its potential biological activity. Its molecular structure suggests that it could participate in various chemical reactions, including esterification and amide bond formation. Additionally, the presence of the carboxylic acid group indicates that it can act as an acid in chemical reactions. Overall, this compound's unique structural features may confer specific properties that could be exploited in various chemical and biological contexts.
Formula:C18H19NO4
InChI:InChI=1S/C18H19NO4/c20-17(21)11-10-14-6-8-15(9-7-14)12-19-18(22)23-13-16-4-2-1-3-5-16/h1-9H,10-13H2,(H,19,22)(H,20,21)
InChI key:InChIKey=XXSSUYZAYWXFJB-UHFFFAOYSA-N
SMILES:C(NC(OCC1=CC=CC=C1)=O)C2=CC=C(CCC(O)=O)C=C2
Synonyms:- Benzenepropanoic acid, 4-[[[(phenylmethoxy)carbonyl]amino]methyl]-
- 4-[[[(Phenylmethoxy)carbonyl]amino]methyl]benzenepropanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-[4-({[(benzyloxy)carbonyl]amino}methyl)phenyl]propanoic acid
CAS:Formula:C18H19NO4Molecular weight:313.3478
