Product correctly added to cart.

2-Aminoquinazoline-6-carbonitrile

CAS 1131604-81-3: 2-Aminoquinazoline-6-carbonitrile

Description:2-Aminoquinazoline-6-carbonitrile is a heterocyclic organic compound characterized by the presence of both an amino group and a carbonitrile group attached to a quinazoline ring system. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential biological activities, including antimicrobial and anticancer properties, making it of interest in pharmaceutical research. The presence of the amino and carbonitrile functional groups contributes to its reactivity and ability to form various derivatives. In terms of solubility, it is generally soluble in polar organic solvents, which is common for compounds containing nitrogen functionalities. The molecular structure allows for various interactions, including hydrogen bonding, which can influence its behavior in biological systems. Additionally, 2-Aminoquinazoline-6-carbonitrile may undergo various chemical reactions, such as nucleophilic substitutions or cyclization, making it a versatile building block in organic synthesis. Overall, its unique structural features and potential applications make it a compound of interest in both medicinal chemistry and material science.

Formula:C9H6N4

InChI:InChI=1S/C9H6N4/c10-4-6-1-2-8-7(3-6)5-12-9(11)13-8/h1-3,5H,(H2,11,12,13)

InChI key:InChIKey=FWPZFWVGDNVXFV-UHFFFAOYSA-N

SMILES:N#CC1=CC=C2N=C(N=CC2=C1)N

Sort by


See more categories

This search does not contain any category.

Found 3 products.

discount label

2-aminoquinazoline-6-carbonitrile

CAS:1131604-81-3

Ref: IN-DA009249

Undefined sizeTo inquire
Estimated delivery in United States, on Tuesday 4 Mar 2025
discount label

2-Aminoquinazoline-6-carbonitrile

CAS:1131604-81-3

Ref: 3D-GVB60481

50mg620.00 €
500mg1,715.00 €
Estimated delivery in United States, on Tuesday 15 Apr 2025
discount label

Ref: 10-F225039

1gDiscontinuedRequest information
100mgDiscontinuedRequest information
250mgDiscontinuedRequest information
Discontinued product
Welcome to CymitQuimica!We use cookies to enhance your visit. We do not include advertising.

Please see our Cookies Policy for more details or adjust your preferences in "Settings".