CAS 1131605-07-6

Ethyl 5-(hydroxymethyl)-2-pyrazinecarboxylate

Description:

Ethyl 5-(hydroxymethyl)-2-pyrazinecarboxylate is a chemical compound characterized by its pyrazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features an ethyl ester functional group, contributing to its solubility in organic solvents. The presence of a hydroxymethyl group at the 5-position of the pyrazine ring enhances its reactivity and potential for further chemical modifications. Ethyl 5-(hydroxymethyl)-2-pyrazinecarboxylate is typically used in organic synthesis and may have applications in pharmaceuticals, agrochemicals, or as a building block in the development of more complex molecules. Its properties, such as boiling point, melting point, and specific reactivity, can vary based on the conditions under which it is handled. Safety data should be consulted to ensure proper handling and storage, as with any chemical substance. Overall, this compound exemplifies the diverse chemistry associated with pyrazine derivatives, which are known for their varied biological activities and functional applications.

Formula: C₈H₁₀N₂O₃

InChI: InChI=1S/C8H10N2O3/c1-2-13-8(12)7-4-9-6(5-11)3-10-7/h3-4,11H,2,5H2,1H3

InChI key: InChIKey=WSEUBHQRMULONJ-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C=NC(CO)=CN1

Synonyms:

• 2-Pyrazinecarboxylic acid, 5-(hydroxymethyl)-, ethyl ester
• Ethyl 5-(hydroxymethyl)-2-pyrazinecarboxylate