CAS 1131605-28-1
:4-[(6-Chloro-3-pyridinyl)amino]cyclohexanone
Description:
4-[(6-Chloro-3-pyridinyl)amino]cyclohexanone, identified by its CAS number 1131605-28-1, is a chemical compound characterized by its unique structure, which includes a cyclohexanone ring substituted with an amino group and a chlorinated pyridine moiety. This compound typically exhibits properties associated with both cyclic ketones and aromatic heterocycles, contributing to its potential biological activity. The presence of the chloro group on the pyridine ring can influence its reactivity and solubility, while the amino group may participate in hydrogen bonding and other interactions. Such structural features suggest that this compound could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, its molecular characteristics may affect its stability, polarity, and interaction with biological systems, making it a candidate for further research in drug design and synthesis. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H13ClN2O
InChI:InChI=1S/C11H13ClN2O/c12-11-6-3-9(7-13-11)14-8-1-4-10(15)5-2-8/h3,6-8,14H,1-2,4-5H2
InChI key:InChIKey=LSZXFLBYTLTYQN-UHFFFAOYSA-N
SMILES:N(C1CCC(=O)CC1)C=2C=CC(Cl)=NC2
Synonyms:- 4-[(6-Chloro-3-pyridinyl)amino]cyclohexanone
- Cyclohexanone, 4-[(6-chloro-3-pyridinyl)amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-[(6-Chloro-3-pyridinyl)amino]cyclohexanone
CAS:Controlled ProductFormula:C11H13ClN2OColor and Shape:NeatMolecular weight:224.687
