CAS 1131605-35-0
:Methyl 2-(dimethylamino)-5-iodobenzoate
Description:
Methyl 2-(dimethylamino)-5-iodobenzoate is an organic compound characterized by its structure, which includes a benzoate moiety substituted with a dimethylamino group and an iodine atom. This compound typically appears as a solid or liquid, depending on its specific form and purity. It is known for its potential applications in medicinal chemistry, particularly in the synthesis of various pharmaceuticals due to the presence of the iodine atom, which can enhance biological activity. The dimethylamino group contributes to its basicity and can influence its solubility in different solvents. Methyl 2-(dimethylamino)-5-iodobenzoate may exhibit moderate to high reactivity, particularly in nucleophilic substitution reactions, making it a valuable intermediate in organic synthesis. Safety data sheets should be consulted for handling and storage guidelines, as the presence of iodine and the dimethylamino group may pose specific health and environmental risks. Overall, this compound is of interest in both research and industrial applications due to its unique chemical properties.
Formula:C10H12INO2
InChI:InChI=1S/C10H12INO2/c1-12(2)9-5-4-7(11)6-8(9)10(13)14-3/h4-6H,1-3H3
InChI key:InChIKey=AFXGJAMDJQFUJL-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(N(C)C)C=CC(I)=C1
Synonyms:- Methyl 2-(dimethylamino)-5-iodobenzoate
- Benzoic acid, 2-(dimethylamino)-5-iodo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
