CymitQuimica logo

CAS 1131605-36-1

:

Cyclohexyl 2-amino-5-iodobenzoate

Description:
Cyclohexyl 2-amino-5-iodobenzoate is an organic compound characterized by its structure, which includes a cyclohexyl group, an amino group, and an iodobenzoate moiety. This compound features a benzene ring substituted with an amino group at the second position and an iodine atom at the fifth position, contributing to its unique reactivity and properties. The presence of the cyclohexyl group enhances its hydrophobic characteristics, potentially influencing its solubility in organic solvents. Cyclohexyl 2-amino-5-iodobenzoate may exhibit biological activity, making it of interest in medicinal chemistry and pharmaceutical research. Its iodine substituent can also facilitate various chemical reactions, such as nucleophilic substitutions or coupling reactions. The compound's stability, reactivity, and potential applications can be influenced by factors such as pH, temperature, and the presence of other reagents. As with many organic compounds, safety precautions should be taken when handling it, considering potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and applications in various fields.
Formula:C13H16INO2
InChI:InChI=1S/C13H16INO2/c14-9-6-7-12(15)11(8-9)13(16)17-10-4-2-1-3-5-10/h6-8,10H,1-5,15H2
InChI key:InChIKey=VUMWMMGMHSJPCB-UHFFFAOYSA-N
SMILES:C(OC1CCCCC1)(=O)C2=C(N)C=CC(I)=C2
Synonyms:
  • Benzoic acid, 2-amino-5-iodo-, cyclohexyl ester
  • Cyclohexyl 2-amino-5-iodobenzoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.