CAS 1131605-37-2
:2-Propen-1-yl 2-amino-5-iodobenzoate
Description:
2-Propen-1-yl 2-amino-5-iodobenzoate, identified by its CAS number 1131605-37-2, is an organic compound characterized by its functional groups and structural features. It contains an amino group (-NH2) and an iodobenzoate moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of the propenyl group indicates that it can participate in various addition reactions, making it a versatile intermediate in chemical reactions. The iodine atom in the structure may enhance the compound's electrophilicity, facilitating nucleophilic substitution reactions. Additionally, the compound's aromatic ring provides stability and can influence its solubility and interaction with other molecules. Overall, 2-Propen-1-yl 2-amino-5-iodobenzoate is significant in medicinal chemistry and materials science, where its unique properties can be harnessed for the development of pharmaceuticals or functional materials. Its specific characteristics, such as melting point, boiling point, and solubility, would require empirical data for precise applications and handling guidelines.
Formula:C10H10INO2
InChI:InChI=1S/C10H10INO2/c1-2-5-14-10(13)8-6-7(11)3-4-9(8)12/h2-4,6H,1,5,12H2
InChI key:InChIKey=RUVDIISBTFYBLA-UHFFFAOYSA-N
SMILES:C(OCC=C)(=O)C1=C(N)C=CC(I)=C1
Synonyms:- Benzoic acid, 2-amino-5-iodo-, 2-propen-1-yl ester
- 2-Propen-1-yl 2-amino-5-iodobenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
