CymitQuimica logo

CAS 1131605-38-3

:

Butyl 2-amino-5-iodobenzoate

Description:
Butyl 2-amino-5-iodobenzoate is an organic compound characterized by its structure, which includes a butyl group, an amino group, and an iodobenzoate moiety. This compound typically appears as a solid or liquid, depending on its specific formulation and purity. It is known for its potential applications in medicinal chemistry and as an intermediate in organic synthesis. The presence of the amino group suggests it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The iodine atom can enhance the compound's reactivity and may also influence its biological activity. Additionally, the butyl group contributes to the hydrophobic character of the molecule, which can affect its solubility and interaction with biological membranes. Overall, Butyl 2-amino-5-iodobenzoate is a versatile compound with significant implications in research and development within the fields of pharmaceuticals and organic chemistry.
Formula:C11H14INO2
InChI:InChI=1S/C11H14INO2/c1-2-3-6-15-11(14)9-7-8(12)4-5-10(9)13/h4-5,7H,2-3,6,13H2,1H3
InChI key:InChIKey=TZPQYLVXOWYKBF-UHFFFAOYSA-N
SMILES:C(OCCCC)(=O)C1=C(N)C=CC(I)=C1
Synonyms:
  • Benzoic acid, 2-amino-5-iodo-, butyl ester
  • Butyl 2-amino-5-iodobenzoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.