
CAS 1131605-41-8
:6-Iodo-1-(2-propen-1-yl)-2H-3,1-benzoxazine-2,4(1H)-dione
Description:
6-Iodo-1-(2-propen-1-yl)-2H-3,1-benzoxazine-2,4(1H)-dione is a chemical compound characterized by its unique structural features, which include a benzoxazine ring system and an iodo substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the iodo group. The propenyl substituent may impart additional reactivity, making it a candidate for various chemical transformations. The presence of the dione functional groups suggests that it may participate in hydrogen bonding and could act as a potential electrophile in reactions. Its molecular structure indicates that it may have applications in organic synthesis, medicinal chemistry, or materials science, particularly in the development of novel compounds with specific biological or chemical properties. As with many benzoxazine derivatives, it may also exhibit interesting thermal and mechanical properties, making it relevant in polymer chemistry. However, specific applications and reactivity would depend on further experimental studies and characterization.
Formula:C11H8INO3
InChI:InChI=1S/C11H8INO3/c1-2-5-13-9-4-3-7(12)6-8(9)10(14)16-11(13)15/h2-4,6H,1,5H2
InChI key:InChIKey=JMGUYKSORCDNJM-UHFFFAOYSA-N
SMILES:C(C=C)N1C=2C(C(=O)OC1=O)=CC(I)=CC2
Synonyms:- 6-Iodo-1-(2-propen-1-yl)-2H-3,1-benzoxazine-2,4(1H)-dione
- 2H-3,1-Benzoxazine-2,4(1H)-dione, 6-iodo-1-(2-propen-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
