CAS 1131605-46-3
:3-Hexen-1-yl 2-amino-5-iodobenzoate
Description:
3-Hexen-1-yl 2-amino-5-iodobenzoate is an organic compound characterized by its structure, which includes a hexenyl chain, an amino group, and an iodobenzoate moiety. This compound features a double bond in the hexenyl group, contributing to its reactivity and potential applications in organic synthesis. The presence of the amino group indicates that it can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The iodine atom in the benzoate structure can also serve as a leaving group or participate in halogenation reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry or agrochemicals. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its practical applications. Overall, 3-Hexen-1-yl 2-amino-5-iodobenzoate represents a versatile chemical entity with potential uses in various fields, including pharmaceuticals and materials science.
Formula:C13H16INO2
InChI:InChI=1S/C13H16INO2/c1-2-3-4-5-8-17-13(16)11-9-10(14)6-7-12(11)15/h3-4,6-7,9H,2,5,8,15H2,1H3
InChI key:InChIKey=KJYGJPOLIBEYPT-UHFFFAOYSA-N
SMILES:C(OCCC=CCC)(=O)C1=C(N)C=CC(I)=C1
Synonyms:- 3-Hexen-1-yl 2-amino-5-iodobenzoate
- Benzoic acid, 2-amino-5-iodo-, 3-hexen-1-yl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
