CymitQuimica logo

CAS 1131614-05-5

:

4-[(Acetyloxy)methyl]-3-iodobenzoic acid

Description:
4-[(Acetyloxy)methyl]-3-iodobenzoic acid is an organic compound characterized by its benzoic acid structure, which includes an iodine atom and an acetyloxy group. The presence of the iodine atom at the 3-position of the benzene ring contributes to its reactivity and potential applications in various chemical reactions, including electrophilic substitutions. The acetyloxy group, located at the 4-position, enhances the compound's solubility and stability, making it suitable for various synthetic pathways. This compound is likely to exhibit moderate polarity due to the carboxylic acid functional group, which can engage in hydrogen bonding. Its molecular structure suggests potential uses in pharmaceuticals or as an intermediate in organic synthesis. Additionally, the compound's unique functional groups may impart specific biological activities, warranting further investigation into its pharmacological properties. As with many halogenated compounds, safety precautions should be observed due to potential toxicity and environmental impact.
Formula:C10H9IO4
InChI:InChI=1S/C10H9IO4/c1-6(12)15-5-8-3-2-7(10(13)14)4-9(8)11/h2-4H,5H2,1H3,(H,13,14)
InChI key:InChIKey=YYIHNJLQJXDLPQ-UHFFFAOYSA-N
SMILES:C(OC(C)=O)C1=C(I)C=C(C(O)=O)C=C1
Synonyms:
  • 4-[(Acetyloxy)methyl]-3-iodobenzoic acid
  • Benzoic acid, 4-[(acetyloxy)methyl]-3-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.