CAS 1131614-11-3
:4-(1,1-Dimethylethoxy)-3-iodobenzoic acid
Description:
4-(1,1-Dimethylethoxy)-3-iodobenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with an iodine atom and a bulky 1,1-dimethylethoxy group. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, such as moderate solubility in organic solvents and potential reactivity in electrophilic substitution reactions due to the presence of the iodine substituent. The bulky 1,1-dimethylethoxy group can influence the compound's steric hindrance, affecting its reactivity and interactions with other molecules. Additionally, the presence of the carboxylic acid group suggests that it can participate in acid-base reactions, potentially forming salts or esters. The iodine atom may also impart unique properties, such as increased molecular weight and potential for further functionalization. Overall, this compound's characteristics make it of interest in various fields, including medicinal chemistry and materials science, where its unique structural features can be leveraged for specific applications.
Formula:C11H13IO3
InChI:InChI=1S/C11H13IO3/c1-11(2,3)15-9-5-4-7(10(13)14)6-8(9)12/h4-6H,1-3H3,(H,13,14)
InChI key:InChIKey=OFXYHLRNWQZWJF-UHFFFAOYSA-N
SMILES:O(C(C)(C)C)C1=C(I)C=C(C(O)=O)C=C1
Synonyms:- Benzoic acid, 4-(1,1-dimethylethoxy)-3-iodo-
- 4-(1,1-Dimethylethoxy)-3-iodobenzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
