CAS 1131614-13-5
:Methyl 3-iodo-4-propoxybenzoate
Description:
Methyl 3-iodo-4-propoxybenzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid. It features a methyl ester group, an iodine atom at the 3-position, and a propoxy group at the 4-position of the benzene ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents such as ethanol and dichloromethane but may have limited solubility in water due to its hydrophobic propoxy group. The presence of the iodine atom can impart unique reactivity, making it useful in various chemical synthesis applications, including nucleophilic substitution reactions. Additionally, the propoxy group can influence the compound's physical properties, such as boiling point and melting point, as well as its biological activity. Methyl 3-iodo-4-propoxybenzoate may be utilized in medicinal chemistry and material science, although specific applications would depend on further research and development.
Formula:C11H13IO3
InChI:InChI=1S/C11H13IO3/c1-3-6-15-10-5-4-8(7-9(10)12)11(13)14-2/h4-5,7H,3,6H2,1-2H3
InChI key:InChIKey=ILSKWROLJWUPQQ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(I)=C(OCCC)C=C1
Synonyms:- Methyl 3-iodo-4-propoxybenzoate
- Benzoic acid, 3-iodo-4-propoxy-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
